C28H11BF10O2 — CID 141052268
(2-fluoro-1H-inden-1-yl)oxy-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane (PubChem CID 141052268) has the molecular formula C28H11BF10O2 and a molecular weight of 580.19 g/mol. Its IUPAC name is (2-fluoro-1H-inden-1-yl)oxy-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane.
| Compound Name | (2-fluoro-1H-inden-1-yl)oxy-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane |
|---|---|
| PubChem CID | 141052268 |
| Molecular Formula | C28H11BF10O2 |
| Molecular Weight | 580.19 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | (2-fluoro-1H-inden-1-yl)oxy-(2,3,4,5,6-pentafluoronaphthalen-1-yl)oxy-(2,3,4,5-tetrafluoro-1H-inden-1-yl)borane |
| SMILES | FC1=Cc2ccccc2C1OB(Oc1c(F)c(F)c(F)c2c(F)c(F)ccc12)C1C(F)=C(F)c2c1ccc(F)c2F |
| InChI | InChI=1S/C28H11BF10O2/c30-14-7-5-12-17(20(14)33)22(35)24(37)19(12)29(40-27-11-4-2-1-3-10(11)9-16(27)32)41-28-13-6-8-15(31)21(34)18(13)23(36)25(38)26(28)39/h1-9,19,27H |
| InChIKey | DWHNPHMHYZWARE-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.19 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|