C7H7F2P — CID 178005158
(3,4-difluoro-2-methylphenyl)phosphane (PubChem CID 178005158) has the molecular formula C7H7F2P and a molecular weight of 160.10 g/mol. Its IUPAC name is (3,4-difluoro-2-methylphenyl)phosphane.
| Compound Name | (3,4-difluoro-2-methylphenyl)phosphane |
|---|---|
| PubChem CID | 178005158 |
| Molecular Formula | C7H7F2P |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | (3,4-difluoro-2-methylphenyl)phosphane |
| SMILES | Cc1c(P)ccc(F)c1F |
| InChI | InChI=1S/C7H7F2P/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,10H2,1H3 |
| InChIKey | CMBXHVZRSSQDEW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|