C9H9ClF2 — CID 130139628
1-(2-chloroethyl)-3,4-difluoro-2-methylbenzene (PubChem CID 130139628) has the molecular formula C9H9ClF2 and a molecular weight of 190.62 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3,4-difluoro-2-methylbenzene.
| Compound Name | 1-(2-chloroethyl)-3,4-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 130139628 |
| Molecular Formula | C9H9ClF2 |
| Molecular Weight | 190.62 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 1-(2-chloroethyl)-3,4-difluoro-2-methylbenzene |
| SMILES | Cc1c(CCCl)ccc(F)c1F |
| InChI | InChI=1S/C9H9ClF2/c1-6-7(4-5-10)2-3-8(11)9(6)12/h2-3H,4-5H2,1H3 |
| InChIKey | AXJJVDVTRHIRGN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|