C10H11F2N3 — CID 71270055
1-(2-azidopropyl)-3,4-difluoro-2-methylbenzene (PubChem CID 71270055) has the molecular formula C10H11F2N3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2-azidopropyl)-3,4-difluoro-2-methylbenzene.
| Compound Name | 1-(2-azidopropyl)-3,4-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 71270055 |
| Molecular Formula | C10H11F2N3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1-(2-azidopropyl)-3,4-difluoro-2-methylbenzene |
| SMILES | Cc1c(CC(C)N=[N+]=[N-])ccc(F)c1F |
| InChI | InChI=1S/C10H11F2N3/c1-6(14-15-13)5-8-3-4-9(11)10(12)7(8)2/h3-4,6H,5H2,1-2H3 |
| InChIKey | YUMCJFIYUZVIPI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|