C12H8F6P2 — CID 143472121
(2,3,4-trifluorophenyl)phosphane;(2,3,5-trifluorophenyl)phosphane (PubChem CID 143472121) has the molecular formula C12H8F6P2 and a molecular weight of 328.13 g/mol. Its IUPAC name is (2,3,4-trifluorophenyl)phosphane;(2,3,5-trifluorophenyl)phosphane.
| Compound Name | (2,3,4-trifluorophenyl)phosphane;(2,3,5-trifluorophenyl)phosphane |
|---|---|
| PubChem CID | 143472121 |
| Molecular Formula | C12H8F6P2 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | (2,3,4-trifluorophenyl)phosphane;(2,3,5-trifluorophenyl)phosphane |
| SMILES | Fc1cc(F)c(F)c(P)c1.Fc1ccc(P)c(F)c1F |
| InChI | InChI=1S/2C6H4F3P/c7-3-1-4(8)6(9)5(10)2-3;7-3-1-2-4(10)6(9)5(3)8/h2*1-2H,10H2 |
| InChIKey | SKJOOEVVOCKFRN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|