C6H3F3OV — CID 162728237
2,3,5-trifluorophenol;vanadium (PubChem CID 162728237) has the molecular formula C6H3F3OV and a molecular weight of 199.03 g/mol. Its IUPAC name is 2,3,5-trifluorophenol;vanadium.
| Compound Name | 2,3,5-trifluorophenol;vanadium |
|---|---|
| PubChem CID | 162728237 |
| Molecular Formula | C6H3F3OV |
| Molecular Weight | 199.03 g/mol |
| Exact Mass | 198.96 |
| IUPAC Name | 2,3,5-trifluorophenol;vanadium |
| SMILES | Oc1cc(F)cc(F)c1F.[V] |
| InChI | InChI=1S/C6H3F3O.V/c7-3-1-4(8)6(9)5(10)2-3;/h1-2,10H; |
| InChIKey | PZBUWMYURXYXAS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.03 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|