C8H6F2O2 — CID 118998346
1-(2,5-difluoro-3-hydroxyphenyl)ethanone (PubChem CID 118998346) has the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. Its IUPAC name is 1-(2,5-difluoro-3-hydroxyphenyl)ethanone.
| Compound Name | 1-(2,5-difluoro-3-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 118998346 |
| Molecular Formula | C8H6F2O2 |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 1-(2,5-difluoro-3-hydroxyphenyl)ethanone |
| SMILES | CC(=O)c1cc(F)cc(O)c1F |
| InChI | InChI=1S/C8H6F2O2/c1-4(11)6-2-5(9)3-7(12)8(6)10/h2-3,12H,1H3 |
| InChIKey | VGYXMGAUQUPOOO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |