C11H12F3NO — CID 175322647
N-[(3,4-difluoro-2-methylphenyl)-fluoromethyl]propanamide (PubChem CID 175322647) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is N-[(3,4-difluoro-2-methylphenyl)-fluoromethyl]propanamide.
| Compound Name | N-[(3,4-difluoro-2-methylphenyl)-fluoromethyl]propanamide |
|---|---|
| PubChem CID | 175322647 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-[(3,4-difluoro-2-methylphenyl)-fluoromethyl]propanamide |
| SMILES | CCC(=O)NC(F)c1ccc(F)c(F)c1C |
| InChI | InChI=1S/C11H12F3NO/c1-3-9(16)15-11(14)7-4-5-8(12)10(13)6(7)2/h4-5,11H,3H2,1-2H3,(H,15,16) |
| InChIKey | GABDYFATLOVOFG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|