C16H13F5N2O — CID 31675054
N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2,3,4-trifluoroanilino)acetamide (PubChem CID 31675054) has the molecular formula C16H13F5N2O and a molecular weight of 344.28 g/mol. Its IUPAC name is N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2,3,4-trifluoroanilino)acetamide.
| Compound Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2,3,4-trifluoroanilino)acetamide |
|---|---|
| PubChem CID | 31675054 |
| Molecular Formula | C16H13F5N2O |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[(1S)-1-(2,4-difluorophenyl)ethyl]-2-(2,3,4-trifluoroanilino)acetamide |
| SMILES | C[C@H](NC(=O)CNc1ccc(F)c(F)c1F)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H13F5N2O/c1-8(10-3-2-9(17)6-12(10)19)23-14(24)7-22-13-5-4-11(18)15(20)16(13)21/h2-6,8,22H,7H2,1H3,(H,23,24)/t8-/m0/s1 |
| InChIKey | LOFGXOLMMWMVCC-QMMMGPOBSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|