C14H20F2N2O — CID 81075854
3-(aminomethyl)-N-[1-(2,4-difluorophenyl)ethyl]pentanamide (PubChem CID 81075854) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(2,4-difluorophenyl)ethyl]pentanamide.
| Compound Name | 3-(aminomethyl)-N-[1-(2,4-difluorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 81075854 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(2,4-difluorophenyl)ethyl]pentanamide |
| SMILES | CCC(CN)CC(=O)NC(C)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H20F2N2O/c1-3-10(8-17)6-14(19)18-9(2)12-5-4-11(15)7-13(12)16/h4-5,7,9-10H,3,6,8,17H2,1-2H3,(H,18,19) |
| InChIKey | ZVOMYBHWYLGZDX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |