C26H8BF11O2 — CID 141042869
bis[(4,5,6,7-tetrafluoronaphthalen-1-yl)oxy]-(2,3,6-trifluorophenyl)borane (PubChem CID 141042869) has the molecular formula C26H8BF11O2 and a molecular weight of 572.14 g/mol. Its IUPAC name is bis[(4,5,6,7-tetrafluoronaphthalen-1-yl)oxy]-(2,3,6-trifluorophenyl)borane.
| Compound Name | bis[(4,5,6,7-tetrafluoronaphthalen-1-yl)oxy]-(2,3,6-trifluorophenyl)borane |
|---|---|
| PubChem CID | 141042869 |
| Molecular Formula | C26H8BF11O2 |
| Molecular Weight | 572.14 g/mol |
| Exact Mass | 572.04 |
| IUPAC Name | bis[(4,5,6,7-tetrafluoronaphthalen-1-yl)oxy]-(2,3,6-trifluorophenyl)borane |
| SMILES | Fc1ccc(F)c(B(Oc2ccc(F)c3c(F)c(F)c(F)cc23)Oc2ccc(F)c3c(F)c(F)c(F)cc23)c1F |
| InChI | InChI=1S/C26H8BF11O2/c28-11-3-5-17(9-7-15(32)23(35)25(37)19(9)11)39-27(21-13(30)1-2-14(31)22(21)34)40-18-6-4-12(29)20-10(18)8-16(33)24(36)26(20)38/h1-8H |
| InChIKey | AZFJDHDIPJXBRZ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.14 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|