C15H9F9Si — CID 102286594
trimethyl-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane (PubChem CID 102286594) has the molecular formula C15H9F9Si and a molecular weight of 388.31 g/mol. Its IUPAC name is trimethyl-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane.
| Compound Name | trimethyl-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane |
|---|---|
| PubChem CID | 102286594 |
| Molecular Formula | C15H9F9Si |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | trimethyl-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane |
| SMILES | C[Si](C)(C)c1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C15H9F9Si/c1-25(2,3)15-13(23)8(18)5(9(19)14(15)24)4-6(16)10(20)12(22)11(21)7(4)17/h1-3H3 |
| InChIKey | PLQSIAZYGVQAPT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|