About CID 134902885
CID 134902885 (PubChem CID 134902885) has the molecular formula C17H18F5Si
and a molecular weight of 345.41 g/mol.
Molecular Properties
| Compound Name | CID 134902885 |
| PubChem CID | 134902885 |
| Molecular Formula | C17H18F5Si |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)=C(C)[C]1[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H18F5Si/c1-7-8(2)10(4)16(9(7)3)23(5,6)17-14(21)12(19)11(18)13(20)15(17)22/h1-6H3 |
| InChIKey | RCZZJFRFBITCPA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134902885 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134902885?
The IUPAC name of CID 134902885 (CID 134902885) is not available.
What is the SMILES notation for CID 134902885?
The canonical SMILES for CID 134902885 is CC1=C(C)C(C)=C(C)[C]1[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F.
What is the InChIKey of CID 134902885?
The InChIKey is RCZZJFRFBITCPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F5Si/c1-7-8(2)10(4)16(9(7)3)23(5,6)17-14(21)12(19)11(18)13(20)15(17)22/h1-6H3.
What are the key properties of CID 134902885?
CID 134902885 has a molecular weight of 345.41 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134902885 is sourced from PubChem (CID 134902885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).