C48F36Si — CID 59336448
tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane (PubChem CID 59336448) has the molecular formula C48F36Si and a molecular weight of 1288.54 g/mol. Its IUPAC name is tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane.
| Compound Name | tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane |
|---|---|
| PubChem CID | 59336448 |
| Molecular Formula | C48F36Si |
| Molecular Weight | 1288.54 g/mol |
| Exact Mass | 1287.92 |
| IUPAC Name | tetrakis[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]silane |
| SMILES | Fc1c(F)c(F)c(-c2c(F)c(F)c([Si](c3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)(c3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C48F36Si/c49-9-1(10(50)26(66)33(73)25(9)65)5-17(57)37(77)45(38(78)18(5)58)85(46-39(79)19(59)6(20(60)40(46)80)2-11(51)27(67)34(74)28(68)12(2)52,47-41(81)21(61)7(22(62)42(47)82)3-13(53)29(69)35(75)30(70)14(3)54)48-43(83)23(63)8(24(64)44(48)84)4-15(55)31(71)36(76)32(72)16(4)56 |
| InChIKey | WUFMCARQOPWHJE-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1288.54 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|