C8F8O — CID 14195971
1,1,3,3,4,5,6,7-octafluoro-2-benzofuran (PubChem CID 14195971) has the molecular formula C8F8O and a molecular weight of 264.07 g/mol. Its IUPAC name is 1,1,3,3,4,5,6,7-octafluoro-2-benzofuran.
| Compound Name | 1,1,3,3,4,5,6,7-octafluoro-2-benzofuran |
|---|---|
| PubChem CID | 14195971 |
| Molecular Formula | C8F8O |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 1,1,3,3,4,5,6,7-octafluoro-2-benzofuran |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)OC2(F)F |
| InChI | InChI=1S/C8F8O/c9-3-1-2(4(10)6(12)5(3)11)8(15,16)17-7(1,13)14 |
| InChIKey | IJZMJXAMUGVDJY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|