C16F24O — CID 87663309
1-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)ethenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 87663309) has the molecular formula C16F24O and a molecular weight of 664.13 g/mol. Its IUPAC name is 1-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)ethenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)ethenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 87663309 |
| Molecular Formula | C16F24O |
| Molecular Weight | 664.13 g/mol |
| Exact Mass | 663.96 |
| IUPAC Name | 1-[2,2-difluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctoxy)ethenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | FC(F)=C(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16F24O/c17-2-1(3(18)5(20)6(21)4(2)19)7(8(22)23)41-16(39,40)14(34,35)12(30,31)10(26,27)9(24,25)11(28,29)13(32,33)15(36,37)38 |
| InChIKey | PVVRNARYAATXTB-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.13 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|