C37H6BF21O2 — CID 141042438
(2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2-(2,3,5-trifluorophenyl)phenoxy]borane (PubChem CID 141042438) has the molecular formula C37H6BF21O2 and a molecular weight of 892.22 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2-(2,3,5-trifluorophenyl)phenoxy]borane.
| Compound Name | (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2-(2,3,5-trifluorophenyl)phenoxy]borane |
|---|---|
| PubChem CID | 141042438 |
| Molecular Formula | C37H6BF21O2 |
| Molecular Weight | 892.22 g/mol |
| Exact Mass | 892.01 |
| IUPAC Name | (2,3,4,5,6,7,8,9,9-nonafluorofluoren-1-yl)-[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenoxy]-[2-(2,3,5-trifluorophenyl)phenoxy]borane |
| SMILES | Fc1cc(F)c(F)c(-c2ccccc2OB(Oc2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c3c2C(F)(F)c2c(F)c(F)c(F)c(F)c2-3)c1 |
| InChI | InChI=1S/C37H6BF21O2/c39-7-5-9(19(41)10(40)6-7)8-3-1-2-4-11(8)60-38(61-36-15(24(46)31(53)34(56)35(36)57)14-22(44)29(51)33(55)30(52)23(14)45)18-16-12(20(42)27(49)26(18)48)13-17(37(16,58)59)25(47)32(54)28(50)21(13)43/h1-6H |
| InChIKey | RBMLKLIWQAPSCT-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.22 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|