C26F20 — CID 134158479
1,1,2,2,3,4,5,6,7,8-decafluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene (PubChem CID 134158479) has the molecular formula C26F20 and a molecular weight of 692.25 g/mol. Its IUPAC name is 1,1,2,2,3,4,5,6,7,8-decafluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene.
| Compound Name | 1,1,2,2,3,4,5,6,7,8-decafluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene |
|---|---|
| PubChem CID | 134158479 |
| Molecular Formula | C26F20 |
| Molecular Weight | 692.25 g/mol |
| Exact Mass | 691.97 |
| IUPAC Name | 1,1,2,2,3,4,5,6,7,8-decafluoro-9,10-bis(2,3,4,5,6-pentafluorophenyl)anthracene |
| SMILES | FC1=C(F)C(F)(F)C(F)(F)c2c1c(-c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1c2-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26F20/c27-9-3-1(6-11(29)18(36)22(40)19(37)12(6)30)5-8(25(43,44)26(45,46)24(42)15(5)33)2(4(3)10(28)17(35)16(9)34)7-13(31)20(38)23(41)21(39)14(7)32 |
| InChIKey | RDJFHDTVVJWVOW-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.25 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|