C32H33F13O3Si — CID 174391868
1,1,2,2,3,4,5,6,7,8,9,10,11-tridecafluorochrysene;triethoxy(octyl)silane (PubChem CID 174391868) has the molecular formula C32H33F13O3Si and a molecular weight of 740.67 g/mol. Its IUPAC name is 1,1,2,2,3,4,5,6,7,8,9,10,11-tridecafluorochrysene;triethoxy(octyl)silane.
| Compound Name | 1,1,2,2,3,4,5,6,7,8,9,10,11-tridecafluorochrysene;triethoxy(octyl)silane |
|---|---|
| PubChem CID | 174391868 |
| Molecular Formula | C32H33F13O3Si |
| Molecular Weight | 740.67 g/mol |
| Exact Mass | 740.20 |
| IUPAC Name | 1,1,2,2,3,4,5,6,7,8,9,10,11-tridecafluorochrysene;triethoxy(octyl)silane |
| SMILES | CCCCCCCC[Si](OCC)(OCC)OCC.FC1=C(F)C(F)(F)C(F)(F)c2cc(F)c3c(c(F)c(F)c4c(F)c(F)c(F)c(F)c43)c21 |
| InChI | InChI=1S/C18HF13.C14H32O3Si/c19-3-1-2-4(13(24)16(27)18(30,31)17(2,28)29)6-5(3)7-8(11(22)9(6)20)12(23)15(26)14(25)10(7)21;1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4/h1H;5-14H2,1-4H3 |
| InChIKey | XHZYUWCBLWPLHO-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.67 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|