C18F16 — CID 12588586
1,1,2,2,3,3,4,4,5,6,7,8,9,10,11,12-hexadecafluorochrysene (PubChem CID 12588586) has the molecular formula C18F16 and a molecular weight of 520.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,6,7,8,9,10,11,12-hexadecafluorochrysene.
| Compound Name | 1,1,2,2,3,3,4,4,5,6,7,8,9,10,11,12-hexadecafluorochrysene |
|---|---|
| PubChem CID | 12588586 |
| Molecular Formula | C18F16 |
| Molecular Weight | 520.17 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,6,7,8,9,10,11,12-hexadecafluorochrysene |
| SMILES | Fc1c(F)c(F)c2c(c1F)c(F)c(F)c1c3c(c(F)c(F)c12)C(F)(F)C(F)(F)C(F)(F)C3(F)F |
| InChI | InChI=1S/C18F16/c19-7-1-2-4(11(23)14(26)13(25)8(2)20)10(22)9(21)3(1)5-6(12(7)24)16(29,30)18(33,34)17(31,32)15(5,27)28 |
| InChIKey | XFHDRLCGFJQALH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.17 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|