C16H12F16 — CID 156740763
1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-dimethylcyclohexane;ethane;1,2,3,4,5,6-hexafluorobenzene (PubChem CID 156740763) has the molecular formula C16H12F16 and a molecular weight of 508.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-dimethylcyclohexane;ethane;1,2,3,4,5,6-hexafluorobenzene.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-dimethylcyclohexane;ethane;1,2,3,4,5,6-hexafluorobenzene |
|---|---|
| PubChem CID | 156740763 |
| Molecular Formula | C16H12F16 |
| Molecular Weight | 508.24 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-6,6-dimethylcyclohexane;ethane;1,2,3,4,5,6-hexafluorobenzene |
| SMILES | CC.CC1(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.Fc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H6F10.C6F6.C2H6/c1-3(2)4(9,10)6(13,14)8(17,18)7(15,16)5(3,11)12;7-1-2(8)4(10)6(12)5(11)3(1)9;1-2/h1-2H3;;1-2H3 |
| InChIKey | WGNQTLZPFAYDLD-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.24 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|