C19F28O — CID 175771436
3,3,4,4,5,6,7,8-octafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-2-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-one (PubChem CID 175771436) has the molecular formula C19F28O and a molecular weight of 776.15 g/mol. Its IUPAC name is 3,3,4,4,5,6,7,8-octafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-2-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-one.
| Compound Name | 3,3,4,4,5,6,7,8-octafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-2-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-one |
|---|---|
| PubChem CID | 175771436 |
| Molecular Formula | C19F28O |
| Molecular Weight | 776.15 g/mol |
| Exact Mass | 775.95 |
| IUPAC Name | 3,3,4,4,5,6,7,8-octafluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-2-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-one |
| SMILES | O=C1c2c(F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)C1(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19F28O/c20-3-1-2(4(21)6(23)5(3)22)9(24,25)10(26,27)8(7(1)48,12(30,31)18(42,43)44)11(28,29)13(32,33)14(34,35)15(36,37)16(38,39)17(40,41)19(45,46)47 |
| InChIKey | WMVNJJSTIBKKFI-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.15 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|