C18F18O — CID 24772957
1,2,3,4,5,6,8,9-octafluoro-4b,10-bis(1,1,2,2,2-pentafluoroethyl)benzo[a]azulen-7-one (PubChem CID 24772957) has the molecular formula C18F18O and a molecular weight of 574.16 g/mol. Its IUPAC name is 1,2,3,4,5,6,8,9-octafluoro-4b,10-bis(1,1,2,2,2-pentafluoroethyl)benzo[a]azulen-7-one.
| Compound Name | 1,2,3,4,5,6,8,9-octafluoro-4b,10-bis(1,1,2,2,2-pentafluoroethyl)benzo[a]azulen-7-one |
|---|---|
| PubChem CID | 24772957 |
| Molecular Formula | C18F18O |
| Molecular Weight | 574.16 g/mol |
| Exact Mass | 573.97 |
| IUPAC Name | 1,2,3,4,5,6,8,9-octafluoro-4b,10-bis(1,1,2,2,2-pentafluoroethyl)benzo[a]azulen-7-one |
| SMILES | O=C1C(F)=C(F)C2=C(C(F)(F)C(F)(F)F)c3c(F)c(F)c(F)c(F)c3C2(C(F)(F)C(F)(F)F)C(F)=C1F |
| InChI | InChI=1S/C18F18O/c19-5-1-2(15(27,28)17(31,32)33)4-7(21)10(24)12(37)11(25)13(26)14(4,16(29,30)18(34,35)36)3(1)6(20)9(23)8(5)22 |
| InChIKey | MHTBVCKETFIUIG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.16 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|