C15H5F9O — CID 100951061
2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-4-prop-2-enylcyclohexa-2,5-dien-1-one (PubChem CID 100951061) has the molecular formula C15H5F9O and a molecular weight of 372.19 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-4-prop-2-enylcyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-4-prop-2-enylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 100951061 |
| Molecular Formula | C15H5F9O |
| Molecular Weight | 372.19 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-4-prop-2-enylcyclohexa-2,5-dien-1-one |
| SMILES | C=CCC1(c2c(F)c(F)c(F)c(F)c2F)C(F)=C(F)C(=O)C(F)=C1F |
| InChI | InChI=1S/C15H5F9O/c1-2-3-15(13(23)10(21)12(25)11(22)14(15)24)4-5(16)7(18)9(20)8(19)6(4)17/h2H,1,3H2 |
| InChIKey | FDJILDWYOYALDW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.19 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|