C14H10Br2F6 — CID 143125257
2,7-dibromo-3,3,4,5,6,6-hexafluoro-2,7-dimethyl-1,8-dihydro-as-indacene (PubChem CID 143125257) has the molecular formula C14H10Br2F6 and a molecular weight of 452.03 g/mol. Its IUPAC name is 2,7-dibromo-3,3,4,5,6,6-hexafluoro-2,7-dimethyl-1,8-dihydro-as-indacene.
| Compound Name | 2,7-dibromo-3,3,4,5,6,6-hexafluoro-2,7-dimethyl-1,8-dihydro-as-indacene |
|---|---|
| PubChem CID | 143125257 |
| Molecular Formula | C14H10Br2F6 |
| Molecular Weight | 452.03 g/mol |
| Exact Mass | 449.91 |
| IUPAC Name | 2,7-dibromo-3,3,4,5,6,6-hexafluoro-2,7-dimethyl-1,8-dihydro-as-indacene |
| SMILES | CC1(Br)Cc2c3c(c(F)c(F)c2C1(F)F)C(F)(F)C(C)(Br)C3 |
| InChI | InChI=1S/C14H10Br2F6/c1-11(15)3-5-6-4-12(2,16)14(21,22)8(6)10(18)9(17)7(5)13(11,19)20/h3-4H2,1-2H3 |
| InChIKey | QKUNCXQESFZTJH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.03 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|