C14H11BrF4 — CID 95565019
(1S,8R)-11-bromo-3,4,5,6-tetrafluoro-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 95565019) has the molecular formula C14H11BrF4 and a molecular weight of 335.14 g/mol. Its IUPAC name is (1S,8R)-11-bromo-3,4,5,6-tetrafluoro-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1S,8R)-11-bromo-3,4,5,6-tetrafluoro-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 95565019 |
| Molecular Formula | C14H11BrF4 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | (1S,8R)-11-bromo-3,4,5,6-tetrafluoro-11-prop-1-en-2-yltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | C=C(C)C1(Br)[C@@H]2CC[C@H]1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C14H11BrF4/c1-5(2)14(15)6-3-4-7(14)9-8(6)10(16)12(18)13(19)11(9)17/h6-7H,1,3-4H2,2H3/t6-,7+,14? |
| InChIKey | IDSMPKFHDMXGJE-IOETWPSPSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|