C13HBrF8 — CID 172727430
9-bromo-1,2,3,4,5,6,7,8-octafluoro-9H-fluorene (PubChem CID 172727430) has the molecular formula C13HBrF8 and a molecular weight of 389.04 g/mol. Its IUPAC name is 9-bromo-1,2,3,4,5,6,7,8-octafluoro-9H-fluorene.
| Compound Name | 9-bromo-1,2,3,4,5,6,7,8-octafluoro-9H-fluorene |
|---|---|
| PubChem CID | 172727430 |
| Molecular Formula | C13HBrF8 |
| Molecular Weight | 389.04 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | 9-bromo-1,2,3,4,5,6,7,8-octafluoro-9H-fluorene |
| SMILES | Fc1c(F)c(F)c2c(c1F)-c1c(F)c(F)c(F)c(F)c1C2Br |
| InChI | InChI=1S/C13HBrF8/c14-5-3-1(6(15)10(19)12(21)8(3)17)2-4(5)9(18)13(22)11(20)7(2)16/h5H |
| InChIKey | HIHGQUSAJBRRLM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|