C13H2Br2F6 — CID 44514074
2,7-dibromo-1,3,4,5,6,8-hexafluoro-9H-fluorene (PubChem CID 44514074) has the molecular formula C13H2Br2F6 and a molecular weight of 431.96 g/mol. Its IUPAC name is 2,7-dibromo-1,3,4,5,6,8-hexafluoro-9H-fluorene.
| Compound Name | 2,7-dibromo-1,3,4,5,6,8-hexafluoro-9H-fluorene |
|---|---|
| PubChem CID | 44514074 |
| Molecular Formula | C13H2Br2F6 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 429.84 |
| IUPAC Name | 2,7-dibromo-1,3,4,5,6,8-hexafluoro-9H-fluorene |
| SMILES | Fc1c(F)c2c(c(F)c1Br)Cc1c(F)c(Br)c(F)c(F)c1-2 |
| InChI | InChI=1S/C13H2Br2F6/c14-6-8(16)2-1-3-5(4(2)10(18)12(6)20)11(19)13(21)7(15)9(3)17/h1H2 |
| InChIKey | TYJCRCGEKJFARE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|