C15Br2F12 — CID 134941195
2,7-dibromo-1,3,4,5,6,8-hexafluoro-9,9-bis(trifluoromethyl)fluorene (PubChem CID 134941195) has the molecular formula C15Br2F12 and a molecular weight of 567.95 g/mol. Its IUPAC name is 2,7-dibromo-1,3,4,5,6,8-hexafluoro-9,9-bis(trifluoromethyl)fluorene.
| Compound Name | 2,7-dibromo-1,3,4,5,6,8-hexafluoro-9,9-bis(trifluoromethyl)fluorene |
|---|---|
| PubChem CID | 134941195 |
| Molecular Formula | C15Br2F12 |
| Molecular Weight | 567.95 g/mol |
| Exact Mass | 565.82 |
| IUPAC Name | 2,7-dibromo-1,3,4,5,6,8-hexafluoro-9,9-bis(trifluoromethyl)fluorene |
| SMILES | Fc1c(F)c2c(c(F)c1Br)C(C(F)(F)F)(C(F)(F)F)c1c(F)c(Br)c(F)c(F)c1-2 |
| InChI | InChI=1S/C15Br2F12/c16-5-9(20)3-1(7(18)11(5)22)2-4(10(21)6(17)12(23)8(2)19)13(3,14(24,25)26)15(27,28)29 |
| InChIKey | DOZSHVWSOJCVRK-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.95 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|