C13H2BrF7 — CID 44514073
2-bromo-1,3,4,5,6,7,8-heptafluoro-9H-fluorene (PubChem CID 44514073) has the molecular formula C13H2BrF7 and a molecular weight of 371.05 g/mol. Its IUPAC name is 2-bromo-1,3,4,5,6,7,8-heptafluoro-9H-fluorene.
| Compound Name | 2-bromo-1,3,4,5,6,7,8-heptafluoro-9H-fluorene |
|---|---|
| PubChem CID | 44514073 |
| Molecular Formula | C13H2BrF7 |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 2-bromo-1,3,4,5,6,7,8-heptafluoro-9H-fluorene |
| SMILES | Fc1c(F)c(F)c2c(c1F)Cc1c(F)c(Br)c(F)c(F)c1-2 |
| InChI | InChI=1S/C13H2BrF7/c14-6-7(15)2-1-3-5(4(2)9(17)11(6)19)10(18)13(21)12(20)8(3)16/h1H2 |
| InChIKey | HGDYSKPSAWEOOO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|