C13H3BrF6 — CID 44514075
2-bromo-1,3,4,5,6,8-hexafluoro-9H-fluorene (PubChem CID 44514075) has the molecular formula C13H3BrF6 and a molecular weight of 353.06 g/mol. Its IUPAC name is 2-bromo-1,3,4,5,6,8-hexafluoro-9H-fluorene.
| Compound Name | 2-bromo-1,3,4,5,6,8-hexafluoro-9H-fluorene |
|---|---|
| PubChem CID | 44514075 |
| Molecular Formula | C13H3BrF6 |
| Molecular Weight | 353.06 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 2-bromo-1,3,4,5,6,8-hexafluoro-9H-fluorene |
| SMILES | Fc1cc(F)c2c(c1F)-c1c(F)c(F)c(Br)c(F)c1C2 |
| InChI | InChI=1S/C13H3BrF6/c14-9-10(17)4-1-3-5(15)2-6(16)11(18)7(3)8(4)12(19)13(9)20/h2H,1H2 |
| InChIKey | UBYSCRVBBTZFCO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.06 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|