C6Br2F8 — CID 23233739
1,2-dibromo-3,3,4,4,5,5,6,6-octafluorocyclohexene (PubChem CID 23233739) has the molecular formula C6Br2F8 and a molecular weight of 383.86 g/mol. Its IUPAC name is 1,2-dibromo-3,3,4,4,5,5,6,6-octafluorocyclohexene.
| Compound Name | 1,2-dibromo-3,3,4,4,5,5,6,6-octafluorocyclohexene |
|---|---|
| PubChem CID | 23233739 |
| Molecular Formula | C6Br2F8 |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 381.82 |
| IUPAC Name | 1,2-dibromo-3,3,4,4,5,5,6,6-octafluorocyclohexene |
| SMILES | FC1(F)C(Br)=C(Br)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6Br2F8/c7-1-2(8)4(11,12)6(15,16)5(13,14)3(1,9)10 |
| InChIKey | XRKKFDVNYCJGDD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|