C5F9N — CID 11021153
2,2,3,3,4,4,5,5,6-nonafluoropyridine (PubChem CID 11021153) has the molecular formula C5F9N and a molecular weight of 245.04 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6-nonafluoropyridine.
| Compound Name | 2,2,3,3,4,4,5,5,6-nonafluoropyridine |
|---|---|
| PubChem CID | 11021153 |
| Molecular Formula | C5F9N |
| Molecular Weight | 245.04 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6-nonafluoropyridine |
| SMILES | FC1=NC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5F9N/c6-1-2(7,8)3(9,10)4(11,12)5(13,14)15-1 |
| InChIKey | KKDUBJRAIPBPLA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.04 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|