C5Cl2F7N — CID 162536645
2,2-dichloro-3,3,4,4,5,5,6-heptafluoropyridine (PubChem CID 162536645) has the molecular formula C5Cl2F7N and a molecular weight of 277.95 g/mol. Its IUPAC name is 2,2-dichloro-3,3,4,4,5,5,6-heptafluoropyridine.
| Compound Name | 2,2-dichloro-3,3,4,4,5,5,6-heptafluoropyridine |
|---|---|
| PubChem CID | 162536645 |
| Molecular Formula | C5Cl2F7N |
| Molecular Weight | 277.95 g/mol |
| Exact Mass | 276.93 |
| IUPAC Name | 2,2-dichloro-3,3,4,4,5,5,6-heptafluoropyridine |
| SMILES | FC1=NC(Cl)(Cl)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5Cl2F7N/c6-5(7)4(13,14)3(11,12)2(9,10)1(8)15-5 |
| InChIKey | VESNNJUSLXONBP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.95 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|