C5BrF7O — CID 10589480
2-bromo-2,3,3,4,4,5,5-heptafluorocyclopentan-1-one (PubChem CID 10589480) has the molecular formula C5BrF7O and a molecular weight of 288.94 g/mol. Its IUPAC name is 2-bromo-2,3,3,4,4,5,5-heptafluorocyclopentan-1-one.
| Compound Name | 2-bromo-2,3,3,4,4,5,5-heptafluorocyclopentan-1-one |
|---|---|
| PubChem CID | 10589480 |
| Molecular Formula | C5BrF7O |
| Molecular Weight | 288.94 g/mol |
| Exact Mass | 287.90 |
| IUPAC Name | 2-bromo-2,3,3,4,4,5,5-heptafluorocyclopentan-1-one |
| SMILES | O=C1C(F)(F)C(F)(F)C(F)(F)C1(F)Br |
| InChI | InChI=1S/C5BrF7O/c6-2(7)1(14)3(8,9)5(12,13)4(2,10)11 |
| InChIKey | NGTJUMDGAQPSJP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.94 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|