C6Br2F6 — CID 23235276
(5S,6R)-5,6-dibromo-1,2,3,4,5,6-hexafluorobicyclo[2.2.0]hex-2-ene (PubChem CID 23235276) has the molecular formula C6Br2F6 and a molecular weight of 345.86 g/mol. Its IUPAC name is (5S,6R)-5,6-dibromo-1,2,3,4,5,6-hexafluorobicyclo[2.2.0]hex-2-ene.
| Compound Name | (5S,6R)-5,6-dibromo-1,2,3,4,5,6-hexafluorobicyclo[2.2.0]hex-2-ene |
|---|---|
| PubChem CID | 23235276 |
| Molecular Formula | C6Br2F6 |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 343.83 |
| IUPAC Name | (5S,6R)-5,6-dibromo-1,2,3,4,5,6-hexafluorobicyclo[2.2.0]hex-2-ene |
| SMILES | FC1=C(F)C2(F)C1(F)[C@](F)(Br)[C@]2(F)Br |
| InChI | InChI=1S/C6Br2F6/c7-5(13)3(11)1(9)2(10)4(3,12)6(5,8)14/t3?,4?,5-,6+ |
| InChIKey | ORBIGFSKUAXLDY-OIMVXCEXSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|