C8H3F7O2 — CID 89386743
1,2,4,5,6,7,7-heptafluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 89386743) has the molecular formula C8H3F7O2 and a molecular weight of 264.10 g/mol. Its IUPAC name is 1,2,4,5,6,7,7-heptafluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 1,2,4,5,6,7,7-heptafluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 89386743 |
| Molecular Formula | C8H3F7O2 |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 1,2,4,5,6,7,7-heptafluorobicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1(F)CC2(F)C(F)=C(F)C1(F)C2(F)F |
| InChI | InChI=1S/C8H3F7O2/c9-2-3(10)7(13)6(12,4(16)17)1-5(2,11)8(7,14)15/h1H2,(H,16,17) |
| InChIKey | ZEWWBGVGNNMGLT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |