C6F7I — CID 13416579
1,2,3,3,4,6,6-heptafluoro-5-iodocyclohexa-1,4-diene (PubChem CID 13416579) has the molecular formula C6F7I and a molecular weight of 331.96 g/mol. Its IUPAC name is 1,2,3,3,4,6,6-heptafluoro-5-iodocyclohexa-1,4-diene.
| Compound Name | 1,2,3,3,4,6,6-heptafluoro-5-iodocyclohexa-1,4-diene |
|---|---|
| PubChem CID | 13416579 |
| Molecular Formula | C6F7I |
| Molecular Weight | 331.96 g/mol |
| Exact Mass | 331.89 |
| IUPAC Name | 1,2,3,3,4,6,6-heptafluoro-5-iodocyclohexa-1,4-diene |
| SMILES | FC1=C(F)C(F)(F)C(I)=C(F)C1(F)F |
| InChI | InChI=1S/C6F7I/c7-1-2(8)6(12,13)4(14)3(9)5(1,10)11 |
| InChIKey | HJOATWOLEDSDIZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|