C11F12 — CID 621373
1,3,4,4,5,7,8,9,10,10,11,11-dodecafluorotricyclo[5.2.2.02,6]undeca-2,5,8-triene (PubChem CID 621373) has the molecular formula C11F12 and a molecular weight of 360.10 g/mol. Its IUPAC name is 1,3,4,4,5,7,8,9,10,10,11,11-dodecafluorotricyclo[5.2.2.02,6]undeca-2,5,8-triene.
| Compound Name | 1,3,4,4,5,7,8,9,10,10,11,11-dodecafluorotricyclo[5.2.2.02,6]undeca-2,5,8-triene |
|---|---|
| PubChem CID | 621373 |
| Molecular Formula | C11F12 |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 1,3,4,4,5,7,8,9,10,10,11,11-dodecafluorotricyclo[5.2.2.02,6]undeca-2,5,8-triene |
| SMILES | FC1=C2C(=C(F)C1(F)F)C1(F)C(F)=C(F)C2(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F12/c12-3-1-2(4(13)9(3,18)19)8(17)6(15)5(14)7(1,16)10(20,21)11(8,22)23 |
| InChIKey | SFCTVOCINHKGEW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|