C4F6O2S — CID 89312231
2,2,3,4,5,5-hexafluorothiophene 1,1-dioxide (PubChem CID 89312231) has the molecular formula C4F6O2S and a molecular weight of 226.10 g/mol. Its IUPAC name is 2,2,3,4,5,5-hexafluorothiophene 1,1-dioxide.
| Compound Name | 2,2,3,4,5,5-hexafluorothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 89312231 |
| Molecular Formula | C4F6O2S |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 225.95 |
| IUPAC Name | 2,2,3,4,5,5-hexafluorothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C(F)(F)C(F)=C(F)C1(F)F |
| InChI | InChI=1S/C4F6O2S/c5-1-2(6)4(9,10)13(11,12)3(1,7)8 |
| InChIKey | XTPOKYTYRGFOBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |