C3F6O3S — CID 23234533
2,2,4,4,5,5-hexafluoro-1,3-oxathiolane 3,3-dioxide (PubChem CID 23234533) has the molecular formula C3F6O3S and a molecular weight of 230.08 g/mol. Its IUPAC name is 2,2,4,4,5,5-hexafluoro-1,3-oxathiolane 3,3-dioxide.
| Compound Name | 2,2,4,4,5,5-hexafluoro-1,3-oxathiolane 3,3-dioxide |
|---|---|
| PubChem CID | 23234533 |
| Molecular Formula | C3F6O3S |
| Molecular Weight | 230.08 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 2,2,4,4,5,5-hexafluoro-1,3-oxathiolane 3,3-dioxide |
| SMILES | O=S1(=O)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C3F6O3S/c4-1(5)2(6,7)13(10,11)3(8,9)12-1 |
| InChIKey | LNGXNXWEZRYSOY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.08 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|