C2ClF3O4S — CID 158657256
4-chloro-4,5,5-trifluoro-1,3,2-dioxathiolane 2,2-dioxide (PubChem CID 158657256) has the molecular formula C2ClF3O4S and a molecular weight of 212.53 g/mol. Its IUPAC name is 4-chloro-4,5,5-trifluoro-1,3,2-dioxathiolane 2,2-dioxide.
| Compound Name | 4-chloro-4,5,5-trifluoro-1,3,2-dioxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 158657256 |
| Molecular Formula | C2ClF3O4S |
| Molecular Weight | 212.53 g/mol |
| Exact Mass | 211.92 |
| IUPAC Name | 4-chloro-4,5,5-trifluoro-1,3,2-dioxathiolane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(F)C(F)(Cl)O1 |
| InChI | InChI=1S/C2ClF3O4S/c3-1(4)2(5,6)10-11(7,8)9-1 |
| InChIKey | MZXVBHOQBPDJME-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.53 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|