C5H2F6O3S — CID 58758037
3,4,4-trifluoro-3-(2,3,3-trifluoroprop-2-enyl)oxathietane 2,2-dioxide (PubChem CID 58758037) has the molecular formula C5H2F6O3S and a molecular weight of 256.12 g/mol. Its IUPAC name is 3,4,4-trifluoro-3-(2,3,3-trifluoroprop-2-enyl)oxathietane 2,2-dioxide.
| Compound Name | 3,4,4-trifluoro-3-(2,3,3-trifluoroprop-2-enyl)oxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 58758037 |
| Molecular Formula | C5H2F6O3S |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 3,4,4-trifluoro-3-(2,3,3-trifluoroprop-2-enyl)oxathietane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(F)C1(F)CC(F)=C(F)F |
| InChI | InChI=1S/C5H2F6O3S/c6-2(3(7)8)1-4(9)5(10,11)14-15(4,12)13/h1H2 |
| InChIKey | FBCDGVJVKDGFAJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|