C4Cl2F6O3S — CID 58383934
3-(2,2-dichloro-1,1,2-trifluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide (PubChem CID 58383934) has the molecular formula C4Cl2F6O3S and a molecular weight of 313.00 g/mol. Its IUPAC name is 3-(2,2-dichloro-1,1,2-trifluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide.
| Compound Name | 3-(2,2-dichloro-1,1,2-trifluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 58383934 |
| Molecular Formula | C4Cl2F6O3S |
| Molecular Weight | 313.00 g/mol |
| Exact Mass | 311.88 |
| IUPAC Name | 3-(2,2-dichloro-1,1,2-trifluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(F)C1(F)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C4Cl2F6O3S/c5-3(6,10)1(7,8)2(9)4(11,12)15-16(2,13)14 |
| InChIKey | SVCYZZLQDQELDO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.00 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|