C6F10O6S2 — CID 14203451
3,4,4-trifluoro-3-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide (PubChem CID 14203451) has the molecular formula C6F10O6S2 and a molecular weight of 422.17 g/mol. Its IUPAC name is 3,4,4-trifluoro-3-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide.
| Compound Name | 3,4,4-trifluoro-3-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 14203451 |
| Molecular Formula | C6F10O6S2 |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | 3,4,4-trifluoro-3-[1,1,2,2-tetrafluoro-2-(3,4,4-trifluoro-2,2-dioxooxathietan-3-yl)ethyl]oxathietane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(F)C1(F)C(F)(F)C(F)(F)C1(F)C(F)(F)OS1(=O)=O |
| InChI | InChI=1S/C6F10O6S2/c7-1(8,3(11)5(13,14)21-23(3,17)18)2(9,10)4(12)6(15,16)22-24(4,19)20 |
| InChIKey | AFGHGSSRMMDFAS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|