C2ClF7O3S2 — CID 15717517
(3-chloro-4,4-difluoro-2,2-dioxooxathietan-3-yl)-pentafluoro-lambda6-sulfane (PubChem CID 15717517) has the molecular formula C2ClF7O3S2 and a molecular weight of 304.59 g/mol. Its IUPAC name is (3-chloro-4,4-difluoro-2,2-dioxooxathietan-3-yl)-pentafluoro-lambda6-sulfane.
| Compound Name | (3-chloro-4,4-difluoro-2,2-dioxooxathietan-3-yl)-pentafluoro-lambda6-sulfane |
|---|---|
| PubChem CID | 15717517 |
| Molecular Formula | C2ClF7O3S2 |
| Molecular Weight | 304.59 g/mol |
| Exact Mass | 303.89 |
| IUPAC Name | (3-chloro-4,4-difluoro-2,2-dioxooxathietan-3-yl)-pentafluoro-lambda6-sulfane |
| SMILES | O=S1(=O)OC(F)(F)C1(Cl)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C2ClF7O3S2/c3-1(15(6,7,8,9)10)2(4,5)13-14(1,11)12 |
| InChIKey | JGKUDIQMPUPPKF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|