C4ClF7O3S — CID 96565657
(3R)-3-(2-chloro-1,1,2,2-tetrafluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide (PubChem CID 96565657) has the molecular formula C4ClF7O3S and a molecular weight of 296.55 g/mol. Its IUPAC name is (3R)-3-(2-chloro-1,1,2,2-tetrafluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide.
| Compound Name | (3R)-3-(2-chloro-1,1,2,2-tetrafluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 96565657 |
| Molecular Formula | C4ClF7O3S |
| Molecular Weight | 296.55 g/mol |
| Exact Mass | 295.91 |
| IUPAC Name | (3R)-3-(2-chloro-1,1,2,2-tetrafluoroethyl)-3,4,4-trifluorooxathietane 2,2-dioxide |
| SMILES | O=S1(=O)OC(F)(F)[C@@]1(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C4ClF7O3S/c5-3(9,10)1(6,7)2(8)4(11,12)15-16(2,13)14/t2-/m1/s1 |
| InChIKey | BLFUBCBUJHLGGX-UWTATZPHSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|