C3H2F4O3S — CID 134896403
4-fluoro-4-(trifluoromethyl)oxathietane 2,2-dioxide (PubChem CID 134896403) has the molecular formula C3H2F4O3S and a molecular weight of 194.10 g/mol. Its IUPAC name is 4-fluoro-4-(trifluoromethyl)oxathietane 2,2-dioxide.
| Compound Name | 4-fluoro-4-(trifluoromethyl)oxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 134896403 |
| Molecular Formula | C3H2F4O3S |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 4-fluoro-4-(trifluoromethyl)oxathietane 2,2-dioxide |
| SMILES | O=S1(=O)CC(F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C3H2F4O3S/c4-2(3(5,6)7)1-11(8,9)10-2/h1H2 |
| InChIKey | YVTQZXROFJBHPQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|