C4H6F4O8S2 — CID 58781638
6,6,10,10-tetrafluoro-4,4-dihydroxy-1,5,7,9,2,4-tetraoxadithiecane 2,2-dioxide (PubChem CID 58781638) has the molecular formula C4H6F4O8S2 and a molecular weight of 322.21 g/mol. Its IUPAC name is 6,6,10,10-tetrafluoro-4,4-dihydroxy-1,5,7,9,2,4-tetraoxadithiecane 2,2-dioxide.
| Compound Name | 6,6,10,10-tetrafluoro-4,4-dihydroxy-1,5,7,9,2,4-tetraoxadithiecane 2,2-dioxide |
|---|---|
| PubChem CID | 58781638 |
| Molecular Formula | C4H6F4O8S2 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.94 |
| IUPAC Name | 6,6,10,10-tetrafluoro-4,4-dihydroxy-1,5,7,9,2,4-tetraoxadithiecane 2,2-dioxide |
| SMILES | O=S1(=O)CS(O)(O)OC(F)(F)OCOC(F)(F)O1 |
| InChI | InChI=1S/C4H6F4O8S2/c5-3(6)13-1-14-4(7,8)16-18(11,12)2-17(9,10)15-3/h9-10H,1-2H2 |
| InChIKey | NONCCNFDZYCKER-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|