C4H6F2O7S2 — CID 134350665
8,8-difluoro-1,5,7,9,2,4-tetraoxadithiecane 2,2,4-trioxide (PubChem CID 134350665) has the molecular formula C4H6F2O7S2 and a molecular weight of 268.21 g/mol. Its IUPAC name is 8,8-difluoro-1,5,7,9,2,4-tetraoxadithiecane 2,2,4-trioxide.
| Compound Name | 8,8-difluoro-1,5,7,9,2,4-tetraoxadithiecane 2,2,4-trioxide |
|---|---|
| PubChem CID | 134350665 |
| Molecular Formula | C4H6F2O7S2 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 8,8-difluoro-1,5,7,9,2,4-tetraoxadithiecane 2,2,4-trioxide |
| SMILES | O=S1CS(=O)(=O)OCOC(F)(F)OCO1 |
| InChI | InChI=1S/C4H6F2O7S2/c5-4(6)10-1-12-14(7)3-15(8,9)13-2-11-4/h1-3H2 |
| InChIKey | AKCZIRXKDZXPIE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|